C24H27ClN2O6 — CID 108929561
[4-[4-[4-(2-chlorophenoxy)butanoyl]piperazine-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108929561) has the molecular formula C24H27ClN2O6 and a molecular weight of 474.94 g/mol. Its IUPAC name is [4-[4-[4-(2-chlorophenoxy)butanoyl]piperazine-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-[4-(2-chlorophenoxy)butanoyl]piperazine-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929561 |
| Molecular Formula | C24H27ClN2O6 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [4-[4-[4-(2-chlorophenoxy)butanoyl]piperazine-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCN(C(=O)CCCOc3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H27ClN2O6/c1-2-31-24(30)33-19-11-9-18(10-12-19)23(29)27-15-13-26(14-16-27)22(28)8-5-17-32-21-7-4-3-6-20(21)25/h3-4,6-7,9-12H,2,5,8,13-17H2,1H3 |
| InChIKey | VXRDRKHHQQKWDF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|