C20H21N3O5 — CID 108533354
ethyl [4-[4-(pyridine-2-carbonyl)piperazine-1-carbonyl]phenyl] carbonate (PubChem CID 108533354) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is ethyl [4-[4-(pyridine-2-carbonyl)piperazine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-(pyridine-2-carbonyl)piperazine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108533354 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl [4-[4-(pyridine-2-carbonyl)piperazine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCN(C(=O)c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-2-27-20(26)28-16-8-6-15(7-9-16)18(24)22-11-13-23(14-12-22)19(25)17-5-3-4-10-21-17/h3-10H,2,11-14H2,1H3 |
| InChIKey | ZOIQQEMXQBGULV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|