C25H26N4O5 — CID 108929563
[4-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108929563) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is [4-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929563 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [4-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCN(C(=O)c3ccc4nc(C)c(C)nc4c3)CC2)cc1 |
| InChI | InChI=1S/C25H26N4O5/c1-4-33-25(32)34-20-8-5-18(6-9-20)23(30)28-11-13-29(14-12-28)24(31)19-7-10-21-22(15-19)27-17(3)16(2)26-21/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | GRGVEMNQNRGVIP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|