C26H27N3O7 — CID 108929534
[4-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108929534) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is [4-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929534 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [4-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazine-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCN(C(=O)c3ccc4c(c3)C(=O)N(C(C)C)C4=O)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O7/c1-4-35-26(34)36-19-8-5-17(6-9-19)22(30)27-11-13-28(14-12-27)23(31)18-7-10-20-21(15-18)25(33)29(16(2)3)24(20)32/h5-10,15-16H,4,11-14H2,1-3H3 |
| InChIKey | SHAXMHNYGLTHFA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|