C19H20N4O4 — CID 108533025
3-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazin-1-yl]-3-oxopropanenitrile (PubChem CID 108533025) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 108533025 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[4-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperazin-1-yl]-3-oxopropanenitrile |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)N3CCN(C(=O)CC#N)CC3)cc2C1=O |
| InChI | InChI=1S/C19H20N4O4/c1-12(2)23-18(26)14-4-3-13(11-15(14)19(23)27)17(25)22-9-7-21(8-10-22)16(24)5-6-20/h3-4,11-12H,5,7-10H2,1-2H3 |
| InChIKey | NAYXWSYXGJOHRS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|