C20H26N4O4 — CID 108564466
3-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-1,1-dimethylurea (PubChem CID 108564466) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-1,1-dimethylurea.
| Compound Name | 3-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 108564466 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-1,1-dimethylurea |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)N3CCC(NC(=O)N(C)C)CC3)cc2C1=O |
| InChI | InChI=1S/C20H26N4O4/c1-12(2)24-18(26)15-6-5-13(11-16(15)19(24)27)17(25)23-9-7-14(8-10-23)21-20(28)22(3)4/h5-6,11-12,14H,7-10H2,1-4H3,(H,21,28) |
| InChIKey | TZKDORBKVGFJHT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|