C22H29N3O4 — CID 108549524
N-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-3-methylbutanamide (PubChem CID 108549524) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-3-methylbutanamide.
| Compound Name | N-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 108549524 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[1-(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)piperidin-4-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1CCN(C(=O)c2ccc3c(c2)C(=O)N(C(C)C)C3=O)CC1 |
| InChI | InChI=1S/C22H29N3O4/c1-13(2)11-19(26)23-16-7-9-24(10-8-16)20(27)15-5-6-17-18(12-15)22(29)25(14(3)4)21(17)28/h5-6,12-14,16H,7-11H2,1-4H3,(H,23,26) |
| InChIKey | RDWZZBPIHIQVCH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|