C26H29N3O4 — CID 108557655
2-methyl-N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]benzamide (PubChem CID 108557655) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]benzamide.
| Compound Name | 2-methyl-N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108557655 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-methyl-N-[1-[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(C(=O)c2ccc3c(c2)C(=O)N(CC(C)C)C3=O)CC1 |
| InChI | InChI=1S/C26H29N3O4/c1-16(2)15-29-25(32)21-9-8-18(14-22(21)26(29)33)24(31)28-12-10-19(11-13-28)27-23(30)20-7-5-4-6-17(20)3/h4-9,14,16,19H,10-13,15H2,1-3H3,(H,27,30) |
| InChIKey | XEPDBYVUZKEZQS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|