C26H29N3O5 — CID 55688991
N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-2-methylbenzamide (PubChem CID 55688991) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-2-methylbenzamide.
| Compound Name | N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55688991 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[1-[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-2-methylbenzamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCC(NC(=O)c4ccccc4C)CC3)cc2C1=O |
| InChI | InChI=1S/C26H29N3O5/c1-17-6-3-4-7-20(17)23(30)27-19-10-13-28(14-11-19)24(31)18-8-9-21-22(16-18)26(33)29(25(21)32)12-5-15-34-2/h3-4,6-9,16,19H,5,10-15H2,1-2H3,(H,27,30) |
| InChIKey | NDHLHEPLPWFLDO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|