C28H31N3O8 — CID 108930323
ethyl [4-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]piperidine-1-carbonyl]phenyl] carbonate (PubChem CID 108930323) has the molecular formula C28H31N3O8 and a molecular weight of 537.57 g/mol. Its IUPAC name is ethyl [4-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]piperidine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]piperidine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108930323 |
| Molecular Formula | C28H31N3O8 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | ethyl [4-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]piperidine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(NC(=O)c3ccc4c(c3)C(=O)N(CCCOC)C4=O)CC2)cc1 |
| InChI | InChI=1S/C28H31N3O8/c1-3-38-28(36)39-21-8-5-18(6-9-21)25(33)30-14-11-20(12-15-30)29-24(32)19-7-10-22-23(17-19)27(35)31(26(22)34)13-4-16-37-2/h5-10,17,20H,3-4,11-16H2,1-2H3,(H,29,32) |
| InChIKey | DNZPEKXXTUHSNB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|