C22H22Cl2N2O5 — CID 108930386
[4-[[1-(2,5-dichlorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108930386) has the molecular formula C22H22Cl2N2O5 and a molecular weight of 465.33 g/mol. Its IUPAC name is [4-[[1-(2,5-dichlorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[1-(2,5-dichlorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930386 |
| Molecular Formula | C22H22Cl2N2O5 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [4-[[1-(2,5-dichlorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NC2CCN(C(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O5/c1-2-30-22(29)31-17-6-3-14(4-7-17)20(27)25-16-9-11-26(12-10-16)21(28)18-13-15(23)5-8-19(18)24/h3-8,13,16H,2,9-12H2,1H3,(H,25,27) |
| InChIKey | VNCGNUKAOXZZLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|