C18H24N2O6 — CID 108563374
[4-[4-(ethoxycarbonylamino)piperidine-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108563374) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is [4-[4-(ethoxycarbonylamino)piperidine-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-(ethoxycarbonylamino)piperidine-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108563374 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [4-[4-(ethoxycarbonylamino)piperidine-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)NC1CCN(C(=O)c2ccc(OC(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C18H24N2O6/c1-3-24-17(22)19-14-9-11-20(12-10-14)16(21)13-5-7-15(8-6-13)26-18(23)25-4-2/h5-8,14H,3-4,9-12H2,1-2H3,(H,19,22) |
| InChIKey | JOXANPHBZDHAEE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|