C22H24N2O8 — CID 108551456
ethyl [4-[4-[(3,4,5-trihydroxybenzoyl)amino]piperidine-1-carbonyl]phenyl] carbonate (PubChem CID 108551456) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is ethyl [4-[4-[(3,4,5-trihydroxybenzoyl)amino]piperidine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-[(3,4,5-trihydroxybenzoyl)amino]piperidine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108551456 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl [4-[4-[(3,4,5-trihydroxybenzoyl)amino]piperidine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(NC(=O)c3cc(O)c(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O8/c1-2-31-22(30)32-16-5-3-13(4-6-16)21(29)24-9-7-15(8-10-24)23-20(28)14-11-17(25)19(27)18(26)12-14/h3-6,11-12,15,25-27H,2,7-10H2,1H3,(H,23,28) |
| InChIKey | VIYXJHBPIJFGOG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|