C20H22N2O5 — CID 108551461
3,4,5-trihydroxy-N-[1-(4-methylbenzoyl)piperidin-4-yl]benzamide (PubChem CID 108551461) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[1-(4-methylbenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[1-(4-methylbenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108551461 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3,4,5-trihydroxy-N-[1-(4-methylbenzoyl)piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(=O)c3cc(O)c(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-12-2-4-13(5-3-12)20(27)22-8-6-15(7-9-22)21-19(26)14-10-16(23)18(25)17(24)11-14/h2-5,10-11,15,23-25H,6-9H2,1H3,(H,21,26) |
| InChIKey | UGWIISKNHKEDEA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|