C19H22N2O6S — CID 108564412
4-methyl-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 108564412) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-methyl-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108564412 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-methyl-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCN(C(=O)c3cc(O)c(O)c(O)c3)CC2)cc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-12-2-4-15(5-3-12)28(26,27)20-14-6-8-21(9-7-14)19(25)13-10-16(22)18(24)17(23)11-13/h2-5,10-11,14,20,22-24H,6-9H2,1H3 |
| InChIKey | ANDQIXNPUMUOIU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|