C17H24N2O4S — CID 94091179
4-methyl-N-[1-[(2R)-oxolane-2-carbonyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 94091179) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-methyl-N-[1-[(2R)-oxolane-2-carbonyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[(2R)-oxolane-2-carbonyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 94091179 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-methyl-N-[1-[(2R)-oxolane-2-carbonyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCN(C(=O)[C@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-13-4-6-15(7-5-13)24(21,22)18-14-8-10-19(11-9-14)17(20)16-3-2-12-23-16/h4-7,14,16,18H,2-3,8-12H2,1H3/t16-/m1/s1 |
| InChIKey | WZHCRZXMUNZIEQ-MRXNPFEDSA-N |
| XLogP | 1.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |