C26H28N2O3S — CID 108563684
3,4-dimethyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 108563684) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3,4-dimethyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108563684 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3,4-dimethyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)cc1C |
| InChI | InChI=1S/C26H28N2O3S/c1-19-8-13-25(18-20(19)2)32(30,31)27-24-14-16-28(17-15-24)26(29)23-11-9-22(10-12-23)21-6-4-3-5-7-21/h3-13,18,24,27H,14-17H2,1-2H3 |
| InChIKey | WUCSGBTXAMMWDB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |