C22H28N2O3S — CID 41470537
N-[1-(4-butylbenzoyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 41470537) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[1-(4-butylbenzoyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-[1-(4-butylbenzoyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 41470537 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[1-(4-butylbenzoyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | CCCCc1ccc(C(=O)N2CCC(NS(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-2-3-7-18-10-12-19(13-11-18)22(25)24-16-14-20(15-17-24)23-28(26,27)21-8-5-4-6-9-21/h4-6,8-13,20,23H,2-3,7,14-17H2,1H3 |
| InChIKey | XIJMZCQOPPMVOU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |