C26H26N2O2 — CID 39512672
2-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzamide (PubChem CID 39512672) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 2-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 39512672 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(C(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H26N2O2/c1-19-7-5-6-10-24(19)25(29)27-23-15-17-28(18-16-23)26(30)22-13-11-21(12-14-22)20-8-3-2-4-9-20/h2-14,23H,15-18H2,1H3,(H,27,29) |
| InChIKey | VBQWIOPLVBRQNZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |