C23H23N3O3 — CID 47800468
5-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide (PubChem CID 47800468) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 5-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 47800468 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 5-methyl-N-[1-(4-phenylbenzoyl)piperidin-4-yl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)no1 |
| InChI | InChI=1S/C23H23N3O3/c1-16-15-21(25-29-16)22(27)24-20-11-13-26(14-12-20)23(28)19-9-7-18(8-10-19)17-5-3-2-4-6-17/h2-10,15,20H,11-14H2,1H3,(H,24,27) |
| InChIKey | QMLCSALLWBHHOQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |