C27H29N3O4S — CID 46678397
N-[1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-4-yl]benzamide (PubChem CID 46678397) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46678397 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)N3CCC(NC(=O)c4ccccc4)CC3)cc2)cc1C |
| InChI | InChI=1S/C27H29N3O4S/c1-19-8-13-25(18-20(19)2)35(33,34)29-24-11-9-22(10-12-24)27(32)30-16-14-23(15-17-30)28-26(31)21-6-4-3-5-7-21/h3-13,18,23,29H,14-17H2,1-2H3,(H,28,31) |
| InChIKey | VOEJBHWNXCQBKE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |