C22H27N3O4S — CID 52507139
N-[(3R)-1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-3-yl]acetamide (PubChem CID 52507139) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[(3R)-1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-3-yl]acetamide.
| Compound Name | N-[(3R)-1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 52507139 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[(3R)-1-[4-[(3,4-dimethylphenyl)sulfonylamino]benzoyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCCN(C(=O)c2ccc(NS(=O)(=O)c3ccc(C)c(C)c3)cc2)C1 |
| InChI | InChI=1S/C22H27N3O4S/c1-15-6-11-21(13-16(15)2)30(28,29)24-19-9-7-18(8-10-19)22(27)25-12-4-5-20(14-25)23-17(3)26/h6-11,13,20,24H,4-5,12,14H2,1-3H3,(H,23,26)/t20-/m1/s1 |
| InChIKey | JEYQGAHUIIIDGH-HXUWFJFHSA-N |
| XLogP | 2.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |