C17H17Cl2N3O3S — CID 127219140
4-chloro-N-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 127219140) has the molecular formula C17H17Cl2N3O3S and a molecular weight of 414.31 g/mol. Its IUPAC name is 4-chloro-N-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 127219140 |
| Molecular Formula | C17H17Cl2N3O3S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 4-chloro-N-[1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCC(NS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H17Cl2N3O3S/c18-13-1-3-15(4-2-13)26(24,25)21-14-6-9-22(10-7-14)17(23)12-5-8-20-16(19)11-12/h1-5,8,11,14,21H,6-7,9-10H2 |
| InChIKey | QXSHUEZVTUEQOF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|