C16H15Cl2N3O3S — CID 34182939
[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(2-chloro-4-pyridinyl)methanone (PubChem CID 34182939) has the molecular formula C16H15Cl2N3O3S and a molecular weight of 400.29 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(2-chloro-4-pyridinyl)methanone.
| Compound Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(2-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 34182939 |
| Molecular Formula | C16H15Cl2N3O3S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-(2-chloro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H15Cl2N3O3S/c17-13-1-3-14(4-2-13)25(23,24)21-9-7-20(8-10-21)16(22)12-5-6-19-15(18)11-12/h1-6,11H,7-10H2 |
| InChIKey | JXEKPBMVLXCAAF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|