C20H22ClN3O3S — CID 34660750
(2-chloro-4-pyridinyl)-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methanone (PubChem CID 34660750) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 34660750 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1 |
| InChI | InChI=1S/C20H22ClN3O3S/c21-19-14-17(7-8-22-19)20(25)23-9-11-24(12-10-23)28(26,27)18-6-5-15-3-1-2-4-16(15)13-18/h5-8,13-14H,1-4,9-12H2 |
| InChIKey | JFKCZDMVUZQJNI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|