C20H24ClN3O3S — CID 32695876
(2-chloro-4-pyridinyl)-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 32695876) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 32695876 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)c3ccnc(Cl)c3)CC2)c1C |
| InChI | InChI=1S/C20H24ClN3O3S/c1-13-11-14(2)16(4)19(15(13)3)28(26,27)24-9-7-23(8-10-24)20(25)17-5-6-22-18(21)12-17/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | PAMMQFDCNRLWGB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|