C21H26FN3O3S — CID 52818634
(2-fluoro-4-pyridinyl)-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 52818634) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is (2-fluoro-4-pyridinyl)-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-fluoro-4-pyridinyl)-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 52818634 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2-fluoro-4-pyridinyl)-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(C(=O)c3ccnc(F)c3)CC2)c(C)c1C |
| InChI | InChI=1S/C21H26FN3O3S/c1-13-14(2)16(4)20(17(5)15(13)3)29(27,28)25-10-8-24(9-11-25)21(26)18-6-7-23-19(22)12-18/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | QFTDHCITUIRMPS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|