C12H15FN2O — CID 79036479
(3,4-dimethylpyrrolidin-1-yl)-(2-fluoro-4-pyridinyl)methanone (PubChem CID 79036479) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is (3,4-dimethylpyrrolidin-1-yl)-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | (3,4-dimethylpyrrolidin-1-yl)-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 79036479 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (3,4-dimethylpyrrolidin-1-yl)-(2-fluoro-4-pyridinyl)methanone |
| SMILES | CC1CN(C(=O)c2ccnc(F)c2)CC1C |
| InChI | InChI=1S/C12H15FN2O/c1-8-6-15(7-9(8)2)12(16)10-3-4-14-11(13)5-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | YZEVBWMCBCNNED-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|