C12H17N3O2 — CID 55043295
(2-amino-4-pyridinyl)-(2,6-dimethylmorpholin-4-yl)methanone (PubChem CID 55043295) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is (2-amino-4-pyridinyl)-(2,6-dimethylmorpholin-4-yl)methanone.
| Compound Name | (2-amino-4-pyridinyl)-(2,6-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 55043295 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (2-amino-4-pyridinyl)-(2,6-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccnc(N)c2)CC(C)O1 |
| InChI | InChI=1S/C12H17N3O2/c1-8-6-15(7-9(2)17-8)12(16)10-3-4-14-11(13)5-10/h3-5,8-9H,6-7H2,1-2H3,(H2,13,14) |
| InChIKey | XHIVVXSYXYZZQC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |