C11H15NO3 — CID 42922601
(2,6-dimethylmorpholin-4-yl)-(furan-3-yl)methanone (PubChem CID 42922601) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(furan-3-yl)methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 42922601 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(furan-3-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccoc2)CC(C)O1 |
| InChI | InChI=1S/C11H15NO3/c1-8-5-12(6-9(2)15-8)11(13)10-3-4-14-7-10/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | CZRWWUGVPMZVRU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |