4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid

C14H17NO4 — CID 93051085

IUPAC4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid
SMILESC[C@@H]1CN(C(=O)c2ccc(C(=O)O)cc2)C[C@@H](C)O1
InChIInChI=1S/C14H17NO4/c1-9-7-15(8-10(2)19-9)13(16)11-3-5-12(6-4-11)14(17)18/h3-6,9-10H,7-8H2,1-2H3,(H,17,18)/t9-,10-/m1/s1
InChIKeyDBDUOILCZAKCJX-NXEZZACHSA-N
MW263.29 g/mol
LogP1.63
Rot. Bonds2

About 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid

4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid (PubChem CID 93051085) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid.

Molecular Properties

Compound Name4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid
PubChem CID93051085
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid
SMILESC[C@@H]1CN(C(=O)c2ccc(C(=O)O)cc2)C[C@@H](C)O1
InChIInChI=1S/C14H17NO4/c1-9-7-15(8-10(2)19-9)13(16)11-3-5-12(6-4-11)14(17)18/h3-6,9-10H,7-8H2,1-2H3,(H,17,18)/t9-,10-/m1/s1
InChIKeyDBDUOILCZAKCJX-NXEZZACHSA-N
XLogP1.63
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid?
The IUPAC name of 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid (CID 93051085) is 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid.
What is the SMILES notation for 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid?
The canonical SMILES for 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid is C[C@@H]1CN(C(=O)c2ccc(C(=O)O)cc2)C[C@@H](C)O1.
What is the InChIKey of 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid?
The InChIKey is DBDUOILCZAKCJX-NXEZZACHSA-N. The full InChI is InChI=1S/C14H17NO4/c1-9-7-15(8-10(2)19-9)13(16)11-3-5-12(6-4-11)14(17)18/h3-6,9-10H,7-8H2,1-2H3,(H,17,18)/t9-,10-/m1/s1.
What are the key properties of 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid?
4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid has a molecular weight of 263.29 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]benzoic acid is sourced from PubChem (CID 93051085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).