C19H24N2O2 — CID 34280429
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone (PubChem CID 34280429) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 34280429 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-[4-(2,5-dimethylpyrrol-1-yl)phenyl]methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-5-6-14(2)21(13)18-9-7-17(8-10-18)19(22)20-11-15(3)23-16(4)12-20/h5-10,15-16H,11-12H2,1-4H3/t15-,16+ |
| InChIKey | KVJOUMKMUHLISE-IYBDPMFKSA-N |
| XLogP | 3.34 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|