C19H21NO2 — CID 7316313
[(2R,6R)-2,6-dimethylmorpholin-4-yl]-(4-phenylphenyl)methanone (PubChem CID 7316313) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(4-phenylphenyl)methanone.
| Compound Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 7316313 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(4-phenylphenyl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(-c3ccccc3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H21NO2/c1-14-12-20(13-15(2)22-14)19(21)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,14-15H,12-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | ULXVRCZTNAIDOX-HUUCEWRRSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |