C14H19N3O3 — CID 42915501
[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]urea (PubChem CID 42915501) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is [4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]urea.
| Compound Name | [4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 42915501 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]urea |
| SMILES | CC1CN(C(=O)c2ccc(NC(N)=O)cc2)CC(C)O1 |
| InChI | InChI=1S/C14H19N3O3/c1-9-7-17(8-10(2)20-9)13(18)11-3-5-12(6-4-11)16-14(15)19/h3-6,9-10H,7-8H2,1-2H3,(H3,15,16,19) |
| InChIKey | YWGIQVMWKRDCLU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |