C18H22N2O5 — CID 129466552
1-[[4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 129466552) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[[4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 129466552 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[[4-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]phenyl]carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(NC(=O)C3(C(=O)O)CC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H22N2O5/c1-11-9-20(10-12(2)25-11)15(21)13-3-5-14(6-4-13)19-16(22)18(7-8-18)17(23)24/h3-6,11-12H,7-10H2,1-2H3,(H,19,22)(H,23,24)/t11-,12+ |
| InChIKey | APFSFAWYGPZSON-TXEJJXNPSA-N |
| XLogP | 1.74 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|