C17H20N2O5S — CID 136541828
N-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]furan-3-sulfonamide (PubChem CID 136541828) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]furan-3-sulfonamide.
| Compound Name | N-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 136541828 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]furan-3-sulfonamide |
| SMILES | CC1CN(C(=O)c2ccc(NS(=O)(=O)c3ccoc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C17H20N2O5S/c1-12-9-19(10-13(2)24-12)17(20)14-3-5-15(6-4-14)18-25(21,22)16-7-8-23-11-16/h3-8,11-13,18H,9-10H2,1-2H3 |
| InChIKey | HXSSMDPOILYNNT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |