C12H15NO4 — CID 919353
5-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]pyran-2-one (PubChem CID 919353) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 5-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]pyran-2-one.
| Compound Name | 5-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]pyran-2-one |
|---|---|
| PubChem CID | 919353 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 5-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]pyran-2-one |
| SMILES | C[C@H]1CN(C(=O)c2ccc(=O)oc2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H15NO4/c1-8-5-13(6-9(2)17-8)12(15)10-3-4-11(14)16-7-10/h3-4,7-9H,5-6H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | DOIVJPKDJWMSJU-IUCAKERBSA-N |
| XLogP | 0.89 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |