C12H15FN2O — CID 143331282
(2-fluoro-4-pyridinyl)-[(3S)-3-methylpiperidin-1-yl]methanone (PubChem CID 143331282) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is (2-fluoro-4-pyridinyl)-[(3S)-3-methylpiperidin-1-yl]methanone.
| Compound Name | (2-fluoro-4-pyridinyl)-[(3S)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 143331282 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (2-fluoro-4-pyridinyl)-[(3S)-3-methylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1CCCN(C(=O)c2ccnc(F)c2)C1 |
| InChI | InChI=1S/C12H15FN2O/c1-9-3-2-6-15(8-9)12(16)10-4-5-14-11(13)7-10/h4-5,7,9H,2-3,6,8H2,1H3/t9-/m0/s1 |
| InChIKey | WRFSRGVHBCLBGU-VIFPVBQESA-N |
| XLogP | 2.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|