C22H27FN4O — CID 109173670
[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109173670) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109173670 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2ccnc(N3CCN(c4ccc(F)cc4)CC3)c2)C1 |
| InChI | InChI=1S/C22H27FN4O/c1-17-3-2-10-27(16-17)22(28)18-8-9-24-21(15-18)26-13-11-25(12-14-26)20-6-4-19(23)5-7-20/h4-9,15,17H,2-3,10-14,16H2,1H3 |
| InChIKey | VDDAYVFBJAWDTR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |