C25H30N4O4S — CID 30749625
[4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 30749625) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is [4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 30749625 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1noc(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4c(C)c(C)c(C)c(C)c4C)CC3)cc2)n1 |
| InChI | InChI=1S/C25H30N4O4S/c1-15-16(2)18(4)23(19(5)17(15)3)34(31,32)29-13-11-28(12-14-29)25(30)22-9-7-21(8-10-22)24-26-20(6)27-33-24/h7-10H,11-14H2,1-6H3 |
| InChIKey | FQBKVGQOBBCWCZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |