C16H22ClN3O3S — CID 75476198
1-(2-chloropyridine-4-carbonyl)-N-cyclopentylpiperidine-3-sulfonamide (PubChem CID 75476198) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is 1-(2-chloropyridine-4-carbonyl)-N-cyclopentylpiperidine-3-sulfonamide.
| Compound Name | 1-(2-chloropyridine-4-carbonyl)-N-cyclopentylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 75476198 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-(2-chloropyridine-4-carbonyl)-N-cyclopentylpiperidine-3-sulfonamide |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCCC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C16H22ClN3O3S/c17-15-10-12(7-8-18-15)16(21)20-9-3-6-14(11-20)24(22,23)19-13-4-1-2-5-13/h7-8,10,13-14,19H,1-6,9,11H2 |
| InChIKey | NZQGCPDJCFUPIY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|