C19H25N3O3S — CID 97348456
(3S)-1-[3-(cyanomethyl)benzoyl]-N-cyclopentylpiperidine-3-sulfonamide (PubChem CID 97348456) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is (3S)-1-[3-(cyanomethyl)benzoyl]-N-cyclopentylpiperidine-3-sulfonamide.
| Compound Name | (3S)-1-[3-(cyanomethyl)benzoyl]-N-cyclopentylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348456 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (3S)-1-[3-(cyanomethyl)benzoyl]-N-cyclopentylpiperidine-3-sulfonamide |
| SMILES | N#CCc1cccc(C(=O)N2CCC[C@H](S(=O)(=O)NC3CCCC3)C2)c1 |
| InChI | InChI=1S/C19H25N3O3S/c20-11-10-15-5-3-6-16(13-15)19(23)22-12-4-9-18(14-22)26(24,25)21-17-7-1-2-8-17/h3,5-6,13,17-18,21H,1-2,4,7-10,12,14H2/t18-/m0/s1 |
| InChIKey | UAUAWMYFDNJSDE-SFHVURJKSA-N |
| XLogP | 2.22 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |