C18H26N4O4S — CID 97348320
(3S)-N-(3-carbamoylphenyl)-3-(cyclopentylsulfamoyl)piperidine-1-carboxamide (PubChem CID 97348320) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is (3S)-N-(3-carbamoylphenyl)-3-(cyclopentylsulfamoyl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(3-carbamoylphenyl)-3-(cyclopentylsulfamoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97348320 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3S)-N-(3-carbamoylphenyl)-3-(cyclopentylsulfamoyl)piperidine-1-carboxamide |
| SMILES | NC(=O)c1cccc(NC(=O)N2CCC[C@H](S(=O)(=O)NC3CCCC3)C2)c1 |
| InChI | InChI=1S/C18H26N4O4S/c19-17(23)13-5-3-8-15(11-13)20-18(24)22-10-4-9-16(12-22)27(25,26)21-14-6-1-2-7-14/h3,5,8,11,14,16,21H,1-2,4,6-7,9-10,12H2,(H2,19,23)(H,20,24)/t16-/m0/s1 |
| InChIKey | HFNJEZXERMRBLV-INIZCTEOSA-N |
| XLogP | 1.64 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |