C17H23F2N3O3S — CID 75476010
3-(cyclopentylsulfamoyl)-N-(2,6-difluorophenyl)piperidine-1-carboxamide (PubChem CID 75476010) has the molecular formula C17H23F2N3O3S and a molecular weight of 387.45 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-(2,6-difluorophenyl)piperidine-1-carboxamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-(2,6-difluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75476010 |
| Molecular Formula | C17H23F2N3O3S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-(2,6-difluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)N1CCCC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C17H23F2N3O3S/c18-14-8-3-9-15(19)16(14)20-17(23)22-10-4-7-13(11-22)26(24,25)21-12-5-1-2-6-12/h3,8-9,12-13,21H,1-2,4-7,10-11H2,(H,20,23) |
| InChIKey | LHZFQBCXERTOET-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |