C14H21N3O3S2 — CID 75476178
N-cyclopentyl-1-(1,3-thiazole-4-carbonyl)piperidine-3-sulfonamide (PubChem CID 75476178) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-cyclopentyl-1-(1,3-thiazole-4-carbonyl)piperidine-3-sulfonamide.
| Compound Name | N-cyclopentyl-1-(1,3-thiazole-4-carbonyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 75476178 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-cyclopentyl-1-(1,3-thiazole-4-carbonyl)piperidine-3-sulfonamide |
| SMILES | O=C(c1cscn1)N1CCCC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C14H21N3O3S2/c18-14(13-9-21-10-15-13)17-7-3-6-12(8-17)22(19,20)16-11-4-1-2-5-11/h9-12,16H,1-8H2 |
| InChIKey | SWMYWFVGOVFBNS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |