C11H16N2OS — CID 62045313
azocan-1-yl(1,3-thiazol-4-yl)methanone (PubChem CID 62045313) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is azocan-1-yl(1,3-thiazol-4-yl)methanone.
| Compound Name | azocan-1-yl(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 62045313 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | azocan-1-yl(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCCCCCC1 |
| InChI | InChI=1S/C11H16N2OS/c14-11(10-8-15-9-12-10)13-6-4-2-1-3-5-7-13/h8-9H,1-7H2 |
| InChIKey | LAUOYLQGROPSLU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |