C11H15N3O3S — CID 55143433
ethyl 4-(1,3-thiazole-4-carbonyl)piperazine-1-carboxylate (PubChem CID 55143433) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is ethyl 4-(1,3-thiazole-4-carbonyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(1,3-thiazole-4-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55143433 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | ethyl 4-(1,3-thiazole-4-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cscn2)CC1 |
| InChI | InChI=1S/C11H15N3O3S/c1-2-17-11(16)14-5-3-13(4-6-14)10(15)9-7-18-8-12-9/h7-8H,2-6H2,1H3 |
| InChIKey | XGTKNKQGXLUEBT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |