C13H20N4OS2 — CID 63343943
2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pentanethioamide (PubChem CID 63343943) has the molecular formula C13H20N4OS2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pentanethioamide.
| Compound Name | 2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pentanethioamide |
|---|---|
| PubChem CID | 63343943 |
| Molecular Formula | C13H20N4OS2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]pentanethioamide |
| SMILES | CCCC(C(N)=S)N1CCN(C(=O)c2cscn2)CC1 |
| InChI | InChI=1S/C13H20N4OS2/c1-2-3-11(12(14)19)16-4-6-17(7-5-16)13(18)10-8-20-9-15-10/h8-9,11H,2-7H2,1H3,(H2,14,19) |
| InChIKey | TXTJRCRDHMZVCA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|