C11H15N3OS2 — CID 107161029
4-methyl-1-(1,3-thiazole-4-carbonyl)piperidine-4-carbothioamide (PubChem CID 107161029) has the molecular formula C11H15N3OS2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-methyl-1-(1,3-thiazole-4-carbonyl)piperidine-4-carbothioamide.
| Compound Name | 4-methyl-1-(1,3-thiazole-4-carbonyl)piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107161029 |
| Molecular Formula | C11H15N3OS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-methyl-1-(1,3-thiazole-4-carbonyl)piperidine-4-carbothioamide |
| SMILES | CC1(C(N)=S)CCN(C(=O)c2cscn2)CC1 |
| InChI | InChI=1S/C11H15N3OS2/c1-11(10(12)16)2-4-14(5-3-11)9(15)8-6-17-7-13-8/h6-7H,2-5H2,1H3,(H2,12,16) |
| InChIKey | CJRLZWGBHWDQBS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|