C14H21N5OS — CID 104670470
2-[4-(pyridazine-4-carbonyl)piperazin-1-yl]pentanethioamide (PubChem CID 104670470) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[4-(pyridazine-4-carbonyl)piperazin-1-yl]pentanethioamide.
| Compound Name | 2-[4-(pyridazine-4-carbonyl)piperazin-1-yl]pentanethioamide |
|---|---|
| PubChem CID | 104670470 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[4-(pyridazine-4-carbonyl)piperazin-1-yl]pentanethioamide |
| SMILES | CCCC(C(N)=S)N1CCN(C(=O)c2ccnnc2)CC1 |
| InChI | InChI=1S/C14H21N5OS/c1-2-3-12(13(15)21)18-6-8-19(9-7-18)14(20)11-4-5-16-17-10-11/h4-5,10,12H,2-3,6-9H2,1H3,(H2,15,21) |
| InChIKey | QWYKAJOPSZNSBD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|